Products 89831-41-4

CAS 89831-41-4 is the registry number for 4-Ethyl-1H-pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethyl-1H-pyrazole-5-carboxylic acid (CAS 89831-41-4) is a chemical compound with the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. IUPAC name: 4-ethyl-1H-pyrazole-5-carboxylic acid. InChIKey: QBKKXFTYXKONGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O2
Molecular weight140.14 g/mol
IUPAC name4-ethyl-1H-pyrazole-5-carboxylic acid
InChIKeyQBKKXFTYXKONGJ-UHFFFAOYSA-N
SMILESCCC1=C(NN=C1)C(=O)O

Computed by PubChem (NCBI)