Products 898377-71-4

CAS 898377-71-4 is the registry number for 2-(Diethylamino)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(diethylamino)-2-methylpropanoic acid (CAS 898377-71-4) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: 2-(diethylamino)-2-methylpropanoic acid. InChIKey: FZWIOCPCWMSNIU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17NO2
Molecular weight159.23 g/mol
IUPAC name2-(diethylamino)-2-methylpropanoic acid
InChIKeyFZWIOCPCWMSNIU-UHFFFAOYSA-N
SMILESCCN(CC)C(C)(C)C(=O)O

Computed by PubChem (NCBI)