CAS 898440-60-3 is the registry number for SOAT-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxy-2-nitrophenyl)benzamide (CAS 898440-60-3) is a chemical compound with the molecular formula C20H16ClN3O6S and a molecular weight of 461.9 g/mol. IUPAC name: 2-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxy-2-nitrophenyl)benzamide. InChIKey: MRWCZTWNWLZLSQ-UHFFFAOYSA-N.
| Molecular formula | C20H16ClN3O6S |
|---|---|
| Molecular weight | 461.9 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)sulfonylamino]-N-(4-methoxy-2-nitrophenyl)benzamide |
| InChIKey | MRWCZTWNWLZLSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NC(=O)C2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)