CAS 89848-14-6 is the registry number for Itraconazole Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one (CAS 89848-14-6) is a chemical compound with the molecular formula C22H27N5O2 and a molecular weight of 393.5 g/mol. IUPAC name: 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one. InChIKey: IKRAGENFWVPBBT-UHFFFAOYSA-N.
| Molecular formula | C22H27N5O2 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-2-propan-2-yl-1,2,4-triazol-3-one |
| InChIKey | IKRAGENFWVPBBT-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)