CAS 898743-92-5 is the registry number for DSM74. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-methyl-N-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS 898743-92-5) is a chemical compound with the molecular formula C13H10F3N5 and a molecular weight of 293.25 g/mol. IUPAC name: 5-methyl-N-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine. InChIKey: LRHHXKBKRNNFRV-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N5 |
|---|---|
| Molecular weight | 293.25 g/mol |
| IUPAC name | 5-methyl-N-[4-(trifluoromethyl)phenyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | LRHHXKBKRNNFRV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC=NN2C(=C1)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)