CAS 898747-98-3 is the registry number for 2,4,7–TRIBROMOBENZOTHIAZOLE. Offered by: GLPBio. Available pack sizes: 10mg, 250mg, 50mg.
2,4,7-tribromo-1,3-benzothiazole (CAS 898747-98-3) is a chemical compound with the molecular formula C7H2Br3NS and a molecular weight of 371.88 g/mol. IUPAC name: 2,4,7-tribromo-1,3-benzothiazole. InChIKey: IUMVKIBMXFBIEM-UHFFFAOYSA-N.
| Molecular formula | C7H2Br3NS |
|---|---|
| Molecular weight | 371.88 g/mol |
| IUPAC name | 2,4,7-tribromo-1,3-benzothiazole |
| InChIKey | IUMVKIBMXFBIEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)N=C(S2)Br)Br |
Computed by PubChem (NCBI)