CAS 898748-05-5 appears in our catalog under these names: 4,7-Dibromo-2-hydrazinylbenzo[d]thiazole 97%, 4,7-Dibromo-2-hydrazinylbenzo[d]thiazole, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4,7-dibromo-1,3-benzothiazol-2-yl)hydrazine (CAS 898748-05-5) is a chemical compound with the molecular formula C7H5Br2N3S and a molecular weight of 323.01 g/mol. IUPAC name: (4,7-dibromo-1,3-benzothiazol-2-yl)hydrazine. InChIKey: JKMWDHCIORLGAE-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2N3S |
|---|---|
| Molecular weight | 323.01 g/mol |
| IUPAC name | (4,7-dibromo-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | JKMWDHCIORLGAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)N=C(S2)NN)Br |
Computed by PubChem (NCBI)