Products 898766-87-5

CAS 898766-87-5 is the registry number for 5-Cyclopropyl-5-oxopentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

5-cyclopropyl-5-oxopentanoic acid (CAS 898766-87-5) is a chemical compound with the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. IUPAC name: 5-cyclopropyl-5-oxopentanoic acid. InChIKey: GHDNXBQUOFVFDF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O3
Molecular weight156.18 g/mol
IUPAC name5-cyclopropyl-5-oxopentanoic acid
InChIKeyGHDNXBQUOFVFDF-UHFFFAOYSA-N
SMILESC1CC1C(=O)CCCC(=O)O

Computed by PubChem (NCBI)