Products 898828-73-4
CAS 898828-73-4 is the registry number for 1,1-Dimethylethyl 3-(6-amino-9H-purin-9-yl)-1-pyrrolidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(6-aminopurin-9-yl)pyrrolidine-1-carboxylate (CAS 898828-73-4) is a chemical compound with the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. IUPAC name: tert-butyl 3-(6-aminopurin-9-yl)pyrrolidine-1-carboxylate. InChIKey: ZTODKFKHRCBKDJ-UHFFFAOYSA-N.
| Molecular formula | C14H20N6O2 |
|---|---|
| Molecular weight | 304.35 g/mol |
| IUPAC name | tert-butyl 3-(6-aminopurin-9-yl)pyrrolidine-1-carboxylate |
| InChIKey | ZTODKFKHRCBKDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)N2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)