CAS 89922-02-1 is the registry number for 1-Methoxy-2-propanone-d5. Offered by: TRC. Available pack sizes: 250mg.
1,1,1,3,3-pentadeuterio-3-methoxypropan-2-one (CAS 89922-02-1) is a chemical compound with the molecular formula C4H8O2 and a molecular weight of 93.14 g/mol. IUPAC name: 1,1,1,3,3-pentadeuterio-3-methoxypropan-2-one. InChIKey: CUZLJOLBIRPEFB-WNWXXORZSA-N.
| Molecular formula | C4H8O2 |
|---|---|
| Molecular weight | 93.14 g/mol |
| IUPAC name | 1,1,1,3,3-pentadeuterio-3-methoxypropan-2-one |
| InChIKey | CUZLJOLBIRPEFB-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])OC |
Computed by PubChem (NCBI)