Products 89924-82-3
CAS 89924-82-3 appears in our catalog under these names: Cyclopropane-2,2,3,3-d4-carboxylic Acid, 99 atom % D, min 98% Chemical Purity, Cyclopropanecarboxylic acid–d4, Cyclopropylcarboxylic acid-d4, 99.58%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 5mg, 5 mg, 10 mg.
2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid (CAS 89924-82-3) is a chemical compound with the molecular formula C4H6O2 and a molecular weight of 90.11 g/mol. IUPAC name: 2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid. InChIKey: YMGUBTXCNDTFJI-LNLMKGTHSA-N.
| Molecular formula | C4H6O2 |
|---|---|
| Molecular weight | 90.11 g/mol |
| IUPAC name | 2,2,3,3-tetradeuteriocyclopropane-1-carboxylic acid |
| InChIKey | YMGUBTXCNDTFJI-LNLMKGTHSA-N |
| SMILES | [2H]C1(C(C1([2H])[2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)