CAS 89939-85-5 is the registry number for [[4,5-Diamino-2-(cyanosulfanyl)phenyl]sulfanyl]formonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4,5-diamino-2-thiocyanatophenyl) thiocyanate (CAS 89939-85-5) is a chemical compound with the molecular formula C8H6N4S2 and a molecular weight of 222.3 g/mol. IUPAC name: (4,5-diamino-2-thiocyanatophenyl) thiocyanate. InChIKey: BVWSSJVMOODZEV-UHFFFAOYSA-N.
| Molecular formula | C8H6N4S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | (4,5-diamino-2-thiocyanatophenyl) thiocyanate |
| InChIKey | BVWSSJVMOODZEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1SC#N)SC#N)N)N |
Computed by PubChem (NCBI)