Products 899430-52-5
CAS 899430-52-5 is the registry number for 2-[2-[2-[3-[[(2-Aminoethyl)amino]carbonyl]phenoxy]-1-azidoethoxy]ethoxy]acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[2-[2-[3-(2-aminoethylcarbamoyl)phenoxy]-1-azidoethoxy]ethoxy]acetic acid (CAS 899430-52-5) is a chemical compound with the molecular formula C15H21N5O6 and a molecular weight of 367.36 g/mol. IUPAC name: 2-[2-[2-[3-(2-aminoethylcarbamoyl)phenoxy]-1-azidoethoxy]ethoxy]acetic acid. InChIKey: MOFDILKXGCXADO-UHFFFAOYSA-N.
| Molecular formula | C15H21N5O6 |
|---|---|
| Molecular weight | 367.36 g/mol |
| IUPAC name | 2-[2-[2-[3-(2-aminoethylcarbamoyl)phenoxy]-1-azidoethoxy]ethoxy]acetic acid |
| InChIKey | MOFDILKXGCXADO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(N=[N+]=[N-])OCCOCC(=O)O)C(=O)NCCN |
Computed by PubChem (NCBI)