CAS 899431-18-6 appears in our catalog under these names: 3-((5-(2,3-Dichlorophenyl)-1H-tetrazol-1-yl)methyl)pyridine Hydrochloride, A 438079 hydrochloride/ 100%, A 438079 hydrochloride, A 438079 HCl 98%, A-438079 HYDROCHLORIDE HYDRATE. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 500mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine;hydrochloride (CAS 899431-18-6) is a chemical compound with the molecular formula C13H10Cl3N5 and a molecular weight of 342.6 g/mol. IUPAC name: 3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine;hydrochloride. InChIKey: MBTJFFMIPPMRGR-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl3N5 |
|---|---|
| Molecular weight | 342.6 g/mol |
| IUPAC name | 3-[[5-(2,3-dichlorophenyl)tetrazol-1-yl]methyl]pyridine;hydrochloride |
| InChIKey | MBTJFFMIPPMRGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=NN=NN2CC3=CN=CC=C3.Cl |
Computed by PubChem (NCBI)