CAS 899539-96-9 appears in our catalog under these names: 5-(4-Fluorophenyl)-2-methyl-2h-1,2,6-thiadiazine-3-carboxylic acid 1,1-dioxide, 95%, 5-(4-Fluorophenyl)-2-methyl-2H-1,2,6-thiadiazine-3-carboxylic acid 1,1-dioxide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-(4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylic acid (CAS 899539-96-9) is a chemical compound with the molecular formula C11H9FN2O4S and a molecular weight of 284.27 g/mol. IUPAC name: 5-(4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylic acid. InChIKey: MZAKUDDHJPSVCL-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O4S |
|---|---|
| Molecular weight | 284.27 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazine-3-carboxylic acid |
| InChIKey | MZAKUDDHJPSVCL-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=NS1(=O)=O)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)