CAS 899710-21-5 appears in our catalog under these names: 5-([(2-Fluorobenzyl)sulfonyl]methyl)-2-furoic acid, 95%, 5-(((2-Fluorobenzyl)sulfonyl)methyl)furan-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid (CAS 899710-21-5) is a chemical compound with the molecular formula C13H11FO5S and a molecular weight of 298.29 g/mol. IUPAC name: 5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid. InChIKey: LQFKQJUZZCYZTB-UHFFFAOYSA-N.
| Molecular formula | C13H11FO5S |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methylsulfonylmethyl]furan-2-carboxylic acid |
| InChIKey | LQFKQJUZZCYZTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)CC2=CC=C(O2)C(=O)O)F |
Computed by PubChem (NCBI)