CAS 89978-39-2 is the registry number for 2-[(Pentachlorophenyl)thio]acetohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,3,4,5,6-pentachlorophenyl)sulfanylacetohydrazide (CAS 89978-39-2) is a chemical compound with the molecular formula C8H5Cl5N2OS and a molecular weight of 354.5 g/mol. IUPAC name: 2-(2,3,4,5,6-pentachlorophenyl)sulfanylacetohydrazide. InChIKey: VRJDBLUTRSPWAI-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl5N2OS |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentachlorophenyl)sulfanylacetohydrazide |
| InChIKey | VRJDBLUTRSPWAI-UHFFFAOYSA-N |
| SMILES | C(C(=O)NN)SC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)