Products 899789-84-5
CAS 899789-84-5 is the registry number for TPα/β antagonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-cyclohexyl-3-[2-(4-methylphenoxy)-5-nitrophenyl]sulfonylurea (CAS 899789-84-5) is a chemical compound with the molecular formula C20H23N3O6S and a molecular weight of 433.5 g/mol. IUPAC name: 1-cyclohexyl-3-[2-(4-methylphenoxy)-5-nitrophenyl]sulfonylurea. InChIKey: IDPWSIWQGCMVFU-UHFFFAOYSA-N.
| Molecular formula | C20H23N3O6S |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | 1-cyclohexyl-3-[2-(4-methylphenoxy)-5-nitrophenyl]sulfonylurea |
| InChIKey | IDPWSIWQGCMVFU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])S(=O)(=O)NC(=O)NC3CCCCC3 |
Computed by PubChem (NCBI)