CAS 899806-25-8 appears in our catalog under these names: 2-Chloro-6-fluorophenylisothiocyanate 95+%, 2-Chloro-6-fluorophenylisothiocyanate, 97%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 10g.
1-chloro-3-fluoro-2-isothiocyanatobenzene (CAS 899806-25-8) is a chemical compound with the molecular formula C7H3ClFNS and a molecular weight of 187.62 g/mol. IUPAC name: 1-chloro-3-fluoro-2-isothiocyanatobenzene. InChIKey: DFQHWRCYXUNZDH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNS |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 1-chloro-3-fluoro-2-isothiocyanatobenzene |
| InChIKey | DFQHWRCYXUNZDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N=C=S)F |
Computed by PubChem (NCBI)