CAS 899902-32-0 is the registry number for (1-((4-Chlorophenyl)sulfonyl)cyclopropyl)(piperidin-1-yl)methanone, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
[1-(4-chlorophenyl)sulfonylcyclopropyl]-piperidin-1-ylmethanone (CAS 899902-32-0) is a chemical compound with the molecular formula C15H18ClNO3S and a molecular weight of 327.8 g/mol. IUPAC name: [1-(4-chlorophenyl)sulfonylcyclopropyl]-piperidin-1-ylmethanone. InChIKey: QUJFREQSEDILST-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO3S |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | [1-(4-chlorophenyl)sulfonylcyclopropyl]-piperidin-1-ylmethanone |
| InChIKey | QUJFREQSEDILST-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2(CC2)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)