CAS 899926-57-9 is the registry number for 3-(4-Chlorophenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione (CAS 899926-57-9) is a chemical compound with the molecular formula C14H15ClN2S and a molecular weight of 278.8 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione. InChIKey: ZNWUAIWHOFGISC-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2S |
|---|---|
| Molecular weight | 278.8 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione |
| InChIKey | ZNWUAIWHOFGISC-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)NC(=S)C(=N2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)