CAS 90001-39-1 is the registry number for N-(5-Bromothiazol-2-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-bromo-1,3-thiazol-2-yl)furan-2-carboxamide (CAS 90001-39-1) is a chemical compound with the molecular formula C8H5BrN2O2S and a molecular weight of 273.11 g/mol. IUPAC name: N-(5-bromo-1,3-thiazol-2-yl)furan-2-carboxamide. InChIKey: AFGSRZLYTCEGFQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2S |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | N-(5-bromo-1,3-thiazol-2-yl)furan-2-carboxamide |
| InChIKey | AFGSRZLYTCEGFQ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=NC=C(S2)Br |
Computed by PubChem (NCBI)