CAS 900019-65-0 appears in our catalog under these names: 3-Bromo-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 3-Bromo-8-chloro-6-(trifluoromethyl)imidazo(1,2-a)pyridine, 95+%, 3-Bromo-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
3-bromo-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 900019-65-0) is a chemical compound with the molecular formula C8H3BrClF3N2 and a molecular weight of 299.47 g/mol. IUPAC name: 3-bromo-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: CTDVYTQLGSEGAH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3N2 |
|---|---|
| Molecular weight | 299.47 g/mol |
| IUPAC name | 3-bromo-8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | CTDVYTQLGSEGAH-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2C=C1C(F)(F)F)Br)Cl |
Computed by PubChem (NCBI)