Products 900134-28-3
CAS 900134-28-3 is the registry number for CID15997213. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(4-ethylpiperazin-1-yl)methyl]-3-(2-fluorophenyl)-6-nitroquinazolin-4-one (CAS 900134-28-3) is a chemical compound with the molecular formula C21H22FN5O3 and a molecular weight of 411.4 g/mol. IUPAC name: 2-[(4-ethylpiperazin-1-yl)methyl]-3-(2-fluorophenyl)-6-nitroquinazolin-4-one. InChIKey: CFFXRIUELQDINN-UHFFFAOYSA-N.
| Molecular formula | C21H22FN5O3 |
|---|---|
| Molecular weight | 411.4 g/mol |
| IUPAC name | 2-[(4-ethylpiperazin-1-yl)methyl]-3-(2-fluorophenyl)-6-nitroquinazolin-4-one |
| InChIKey | CFFXRIUELQDINN-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=NC3=C(C=C(C=C3)[N+](=O)[O-])C(=O)N2C4=CC=CC=C4F |
Computed by PubChem (NCBI)