Products 9002-61-3
CAS 9002-61-3 appears in our catalog under these names: Chorionic gonadotrophin, Chorionic gonadotrophin, Chorionic Gonadotropin, Huma 1PC X 1MG, Chorionic Gonadotropin, Huma 1PC X 2.5MG, Chorionic gonadotropin human, lyophiliz. Offered by: GLPBio, MedChemExpress, Sigma-Aldrich. Available pack sizes: 5000u, 2000 U, 1MG, 2.5MG, 10VL, 1VL, 50IU.
(2S)-2-amino-6-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-6-oxohexanoic acid (CAS 9002-61-3) is a chemical compound with the molecular formula C11H19N3O6S and a molecular weight of 321.35 g/mol. IUPAC name: (2S)-2-amino-6-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-6-oxohexanoic acid. InChIKey: XFOOPZIJVVDYHI-BQBZGAKWSA-N.
| Molecular formula | C11H19N3O6S |
|---|---|
| Molecular weight | 321.35 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-6-oxohexanoic acid |
| InChIKey | XFOOPZIJVVDYHI-BQBZGAKWSA-N |
| SMILES | C(C[C@@H](C(=O)O)N)CC(=O)N[C@@H](CS)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)