CAS 90027-14-8 is the registry number for 4-Methyl-2-(4,5,6,7-tetrachloro-1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoic acid (CAS 90027-14-8) is a chemical compound with the molecular formula C14H11Cl4NO4 and a molecular weight of 399.0 g/mol. IUPAC name: 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoic acid. InChIKey: BHFNZHRVWJEXDC-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl4NO4 |
|---|---|
| Molecular weight | 399.0 g/mol |
| IUPAC name | 4-methyl-2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)pentanoic acid |
| InChIKey | BHFNZHRVWJEXDC-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C(=O)O)N1C(=O)C2=C(C1=O)C(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)