CAS 900503-70-0 appears in our catalog under these names: (S)-2-(tert-Butyl)-3-methylimidazolidin-4-one 2,2,2-trifluoroacetate, 98%, (S)-(+)-2-(TERT-BUTYL)-3-METHYL-4-IMIDA&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 500MG.
(2S)-2-tert-butyl-3-methylimidazolidin-4-one;2,2,2-trifluoroacetic acid (CAS 900503-70-0) is a chemical compound with the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. IUPAC name: (2S)-2-tert-butyl-3-methylimidazolidin-4-one;2,2,2-trifluoroacetic acid. InChIKey: HKHKOEMMPVPVOS-FJXQXJEOSA-N.
| Molecular formula | C10H17F3N2O3 |
|---|---|
| Molecular weight | 270.25 g/mol |
| IUPAC name | (2S)-2-tert-butyl-3-methylimidazolidin-4-one;2,2,2-trifluoroacetic acid |
| InChIKey | HKHKOEMMPVPVOS-FJXQXJEOSA-N |
| SMILES | CC(C)(C)[C@H]1NCC(=O)N1C.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)