CAS 900640-75-7 is the registry number for 3-Methyl-5-(piperazine-1-sulfonyl)thiophene-2,4-dicarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-methyl-5-piperazin-1-ylsulfonylthiophene-2,4-dicarboxylic acid (CAS 900640-75-7) is a chemical compound with the molecular formula C11H14N2O6S2 and a molecular weight of 334.4 g/mol. IUPAC name: 3-methyl-5-piperazin-1-ylsulfonylthiophene-2,4-dicarboxylic acid. InChIKey: WEKGYLLHXQBDJM-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O6S2 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 3-methyl-5-piperazin-1-ylsulfonylthiophene-2,4-dicarboxylic acid |
| InChIKey | WEKGYLLHXQBDJM-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)O)S(=O)(=O)N2CCNCC2)C(=O)O |
Computed by PubChem (NCBI)