Products 9007-49-2
CAS 9007-49-2 appears in our catalog under these names: Deoxyribonucleic Acid Sodium Salt from Salmon Milt, Deoxyribonucleic acid, Salmon Sperm DNA sodium salt, from salmon sperm, 5 g, plastic, Salmon Sperm DNA sodium salt, from salmon sperm, 10 g, plastic, Deoxyribonucleic Acid, Sodiu 1PC X 1GM. Offered by: TCI, MedChemExpress, Roth, Sigma-Aldrich. Available pack sizes: 5g, 25g, 500 mg, 1 g, 10g, -, 10UG.
[5-amino-2-[[[5-amino-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphoryl]oxymethyl]oxolan-3-yl] (5-amino-3-hydroxyoxolan-2-yl)methyl hydrogen phosphate (CAS 9007-49-2) is a chemical compound with the molecular formula C15H31N3O13P2 and a molecular weight of 523.37 g/mol. IUPAC name: [5-amino-2-[[[5-amino-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphoryl]oxymethyl]oxolan-3-yl] (5-amino-3-hydroxyoxolan-2-yl)methyl hydrogen phosphate. InChIKey: AWBASQCACWFTGD-UHFFFAOYSA-N.
| Molecular formula | C15H31N3O13P2 |
|---|---|
| Molecular weight | 523.37 g/mol |
| IUPAC name | [5-amino-2-[[[5-amino-2-(hydroxymethyl)oxolan-3-yl]oxy-hydroxyphosphoryl]oxymethyl]oxolan-3-yl] (5-amino-3-hydroxyoxolan-2-yl)methyl hydrogen phosphate |
| InChIKey | AWBASQCACWFTGD-UHFFFAOYSA-N |
| SMILES | C1C(C(OC1N)COP(=O)(O)OC2CC(OC2COP(=O)(O)OC3CC(OC3CO)N)N)O |
Computed by PubChem (NCBI)