CAS 9007-81-2 appears in our catalog under these names: Complete Freund's adjuvant (CFA), Complete Freund's adjuvant (CFA, 1 mg/ml). Offered by: MedChemExpress. Available pack sizes: 10 mL, 10 mL * 5, 10 mL * 2.
4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one (CAS 9007-81-2) is a chemical compound with the molecular formula C9H12FN3O5 and a molecular weight of 261.21 g/mol. IUPAC name: 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one. InChIKey: STRZQWQNZQMHQR-UHFFFAOYSA-N.
| Molecular formula | C9H12FN3O5 |
|---|---|
| Molecular weight | 261.21 g/mol |
| IUPAC name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidin-2-one |
| InChIKey | STRZQWQNZQMHQR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)F |
Computed by PubChem (NCBI)