Products 900747-32-2
CAS 900747-32-2 is the registry number for N-(2-chloro-4-(trifluoromethyl)phenyl)benzamide, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
N-[2-chloro-4-(trifluoromethyl)phenyl]benzamide (CAS 900747-32-2) is a chemical compound with the molecular formula C14H9ClF3NO and a molecular weight of 299.67 g/mol. IUPAC name: N-[2-chloro-4-(trifluoromethyl)phenyl]benzamide. InChIKey: UZUVFYVOXCQDKU-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO |
|---|---|
| Molecular weight | 299.67 g/mol |
| IUPAC name | N-[2-chloro-4-(trifluoromethyl)phenyl]benzamide |
| InChIKey | UZUVFYVOXCQDKU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)