CAS 90098-05-8 appears in our catalog under these names: Rebamipide 3-Chloro Impurity, Rebamipide 3-Chloro Impurity (>80%), >95% (HPLC), Rebamipide 3-Chloro Impurity, >95% (HPLC), 2-(3-Chlorobenzamido)-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid, Rebamipide 3-Cl Impurity 98%. Offered by: Chemat Brand, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 50mg, 1mg, 5mg, 10mg, 25mg.
2-[(3-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoic acid (CAS 90098-05-8) is a chemical compound with the molecular formula C19H15ClN2O4 and a molecular weight of 370.8 g/mol. IUPAC name: 2-[(3-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoic acid. InChIKey: BDWGQNMAAZVUQH-UHFFFAOYSA-N.
| Molecular formula | C19H15ClN2O4 |
|---|---|
| Molecular weight | 370.8 g/mol |
| IUPAC name | 2-[(3-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoic acid |
| InChIKey | BDWGQNMAAZVUQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)NC(=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)