CAS 901-93-9 appears in our catalog under these names: Estrone Acetate, Estrone 3-Acetate, >95% (HPLC), Estrone 3-Acetate, (8R,9S,13S,14S)-13-Methyl-17-oxo-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthren-3-yl acetate, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, Chemat, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 50mg, 100mg, 1g, 5g, 25 mg.
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (CAS 901-93-9) is a chemical compound with the molecular formula C20H24O3 and a molecular weight of 312.4 g/mol. IUPAC name: [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate. InChIKey: KDPQTPZDVJHMET-XSYGEPLQSA-N.
| Molecular formula | C20H24O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| InChIKey | KDPQTPZDVJHMET-XSYGEPLQSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)[C@H]3CC[C@]4([C@H]([C@@H]3CC2)CCC4=O)C |
Computed by PubChem (NCBI)