CAS 90104-48-6 is the registry number for Doreptide. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-N-[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-2-phenylbutan-2-yl]pyrrolidine-2-carboxamide (CAS 90104-48-6) is a chemical compound with the molecular formula C17H24N4O3 and a molecular weight of 332.4 g/mol. IUPAC name: (2S)-N-[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-2-phenylbutan-2-yl]pyrrolidine-2-carboxamide. InChIKey: ZALQKBPFOWAOHH-SUMWQHHRSA-N.
| Molecular formula | C17H24N4O3 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | (2S)-N-[(2R)-1-[(2-amino-2-oxoethyl)amino]-1-oxo-2-phenylbutan-2-yl]pyrrolidine-2-carboxamide |
| InChIKey | ZALQKBPFOWAOHH-SUMWQHHRSA-N |
| SMILES | CC[C@@](C1=CC=CC=C1)(C(=O)NCC(=O)N)NC(=O)[C@@H]2CCCN2 |
Computed by PubChem (NCBI)