Products 90137-14-7
CAS 90137-14-7 is the registry number for Pivalaldehyde-d9. Offered by: TRC, Biosynth. Available pack sizes: 1g, 1000mg.
3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanal (CAS 90137-14-7) is a chemical compound with the molecular formula C5H10O and a molecular weight of 95.19 g/mol. IUPAC name: 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanal. InChIKey: FJJYHTVHBVXEEQ-GQALSZNTSA-N.
| Molecular formula | C5H10O |
|---|---|
| Molecular weight | 95.19 g/mol |
| IUPAC name | 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanal |
| InChIKey | FJJYHTVHBVXEEQ-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C=O)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)