CAS 901599-23-3 is the registry number for N-(3-Bromophenyl)thiazole-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-bromophenyl)-1,3-thiazole-5-carboxamide (CAS 901599-23-3) is a chemical compound with the molecular formula C10H7BrN2OS and a molecular weight of 283.15 g/mol. IUPAC name: N-(3-bromophenyl)-1,3-thiazole-5-carboxamide. InChIKey: VJWXKQJHNPFXSS-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2OS |
|---|---|
| Molecular weight | 283.15 g/mol |
| IUPAC name | N-(3-bromophenyl)-1,3-thiazole-5-carboxamide |
| InChIKey | VJWXKQJHNPFXSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)NC(=O)C2=CN=CS2 |
Computed by PubChem (NCBI)