Products 90217-02-0

CAS 90217-02-0 appears in our catalog under these names: 5-Cyano-2,3-di-p-tolyltetrazolium Chloride (>85%), 5–Cyano–2,3–di–(p–tolyl)tetrazolium (chloride), 5-Cyano-2,3-di-(p-tolyl)tetrazolium chloride, 5-CYANO-2,3-DI-(P-TOLYL)TETRAZOLIUM CHL&, 5-Cyano-2,3-di-p-tolyltetrazolium chloride, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 0,5g, 0,25g, 1g.

Structural formula: {0} (CAS {1})

2,3-bis(4-methylphenyl)tetrazol-2-ium-5-carbonitrile chloride (CAS 90217-02-0) is a chemical compound with the molecular formula C16H14ClN5 and a molecular weight of 311.77 g/mol. IUPAC name: 2,3-bis(4-methylphenyl)tetrazol-2-ium-5-carbonitrile chloride. InChIKey: SSJZAXOTLCJNLF-UHFFFAOYSA-M.

Identity
Molecular formulaC16H14ClN5
Molecular weight311.77 g/mol
IUPAC name2,3-bis(4-methylphenyl)tetrazol-2-ium-5-carbonitrile chloride
InChIKeySSJZAXOTLCJNLF-UHFFFAOYSA-M
SMILESCC1=CC=C(C=C1)N2N=C(N=[N+]2C3=CC=C(C=C3)C)C#N.[Cl-]

Computed by PubChem (NCBI)