CAS 902456-04-6 is the registry number for 1-Benzoyl-4-(2,3-dichlorophenyl)piperazine 4-Oxide. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
[4-(2,3-dichlorophenyl)-4-oxidopiperazin-4-ium-1-yl]-phenylmethanone (CAS 902456-04-6) is a chemical compound with the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.2 g/mol. IUPAC name: [4-(2,3-dichlorophenyl)-4-oxidopiperazin-4-ium-1-yl]-phenylmethanone. InChIKey: SSYBKQMHVNGVSD-UHFFFAOYSA-N.
| Molecular formula | C17H16Cl2N2O2 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | [4-(2,3-dichlorophenyl)-4-oxidopiperazin-4-ium-1-yl]-phenylmethanone |
| InChIKey | SSYBKQMHVNGVSD-UHFFFAOYSA-N |
| SMILES | C1C[N+](CCN1C(=O)C2=CC=CC=C2)(C3=C(C(=CC=C3)Cl)Cl)[O-] |
Computed by PubChem (NCBI)