Products 90247-09-9
CAS 90247-09-9 is the registry number for A 56234. Offered by: MedChemExpress. Available pack sizes: Get quote.
Potassium 8-chloro-3-(2-fluorophenyl)-5,6-dihydrofuro[3,2-f][1,2]benzoxazole-6-carboxylate (CAS 90247-09-9) is a chemical compound with the molecular formula C16H8ClFKNO4 and a molecular weight of 371.79 g/mol. IUPAC name: potassium 8-chloro-3-(2-fluorophenyl)-5,6-dihydrofuro[3,2-f][1,2]benzoxazole-6-carboxylate. InChIKey: KXVORPOLZSNEGK-UHFFFAOYSA-M.
| Molecular formula | C16H8ClFKNO4 |
|---|---|
| Molecular weight | 371.79 g/mol |
| IUPAC name | potassium 8-chloro-3-(2-fluorophenyl)-5,6-dihydrofuro[3,2-f][1,2]benzoxazole-6-carboxylate |
| InChIKey | KXVORPOLZSNEGK-UHFFFAOYSA-M |
| SMILES | C1C(OC2=C(C3=C(C=C21)C(=NO3)C4=CC=CC=C4F)Cl)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)
Synonyms:
A-53385 potassium