CAS 90261-67-9 appears in our catalog under these names: Ethyl 4-(bromomethyl)-5,5-dimethyl-2-oxo-2,5-dihydrofuran-3-carboxylate, 95%, Ethyl 4-(bromomethyl)-5,5-dimethyl-2-oxo-2,5-dihydrofuran-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Ethyl 4-(bromomethyl)-5,5-dimethyl-2-oxofuran-3-carboxylate (CAS 90261-67-9) is a chemical compound with the molecular formula C10H13BrO4 and a molecular weight of 277.11 g/mol. IUPAC name: ethyl 4-(bromomethyl)-5,5-dimethyl-2-oxofuran-3-carboxylate. InChIKey: ZLRRMBMCNDBRAW-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO4 |
|---|---|
| Molecular weight | 277.11 g/mol |
| IUPAC name | ethyl 4-(bromomethyl)-5,5-dimethyl-2-oxofuran-3-carboxylate |
| InChIKey | ZLRRMBMCNDBRAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(OC1=O)(C)C)CBr |
Computed by PubChem (NCBI)