Products 90271-21-9

CAS 90271-21-9 appears in our catalog under these names: 2,2-Dimethyltetrahydro-4h-thiopyran-4-one 1,1-dioxide, 95%, 2,2-Dimethyldihydro-2H-thiopyran-4(3H)-one 1,1-dioxide, 97%, 2,2-dimethyltetrahydro-4H-thiopyran-4-one 1,1-dioxide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-1,1-dioxothian-4-one (CAS 90271-21-9) is a chemical compound with the molecular formula C7H12O3S and a molecular weight of 176.24 g/mol. IUPAC name: 2,2-dimethyl-1,1-dioxothian-4-one. InChIKey: YKXNFIMMZYPOCI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O3S
Molecular weight176.24 g/mol
IUPAC name2,2-dimethyl-1,1-dioxothian-4-one
InChIKeyYKXNFIMMZYPOCI-UHFFFAOYSA-N
SMILESCC1(CC(=O)CCS1(=O)=O)C

Computed by PubChem (NCBI)