Products 90273-31-7

CAS 90273-31-7 is the registry number for 2-Methyl-1-benzothiophene-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-methyl-1-benzothiophene-3-sulfonyl chloride (CAS 90273-31-7) is a chemical compound with the molecular formula C9H7ClO2S2 and a molecular weight of 246.7 g/mol. IUPAC name: 2-methyl-1-benzothiophene-3-sulfonyl chloride. InChIKey: OPIFKAGXIKNRIR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7ClO2S2
Molecular weight246.7 g/mol
IUPAC name2-methyl-1-benzothiophene-3-sulfonyl chloride
InChIKeyOPIFKAGXIKNRIR-UHFFFAOYSA-N
SMILESCC1=C(C2=CC=CC=C2S1)S(=O)(=O)Cl

Computed by PubChem (NCBI)