Products 90278-40-3
CAS 90278-40-3 is the registry number for KY-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
7,9-dibromo-N-methyl-8-oxo-1-oxa-2-azaspiro[4.5]deca-2,6,9-triene-3-carboxamide (CAS 90278-40-3) is a chemical compound with the molecular formula C10H8Br2N2O3 and a molecular weight of 363.99 g/mol. IUPAC name: 7,9-dibromo-N-methyl-8-oxo-1-oxa-2-azaspiro[4.5]deca-2,6,9-triene-3-carboxamide. InChIKey: PUMNNXJAHCJGDV-UHFFFAOYSA-N.
| Molecular formula | C10H8Br2N2O3 |
|---|---|
| Molecular weight | 363.99 g/mol |
| IUPAC name | 7,9-dibromo-N-methyl-8-oxo-1-oxa-2-azaspiro[4.5]deca-2,6,9-triene-3-carboxamide |
| InChIKey | PUMNNXJAHCJGDV-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NOC2(C1)C=C(C(=O)C(=C2)Br)Br |
Computed by PubChem (NCBI)