CAS 90283-09-3 appears in our catalog under these names: Oxaprozin Acyl Glucuronide, Oxaprozin Glucuronide, Oxaprozin acyl-β-D-glucuronide. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 25mg, 10mg, 1mg, 2mg, 5mg.
(2S,3S,4S,5R,6S)-6-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (CAS 90283-09-3) is a chemical compound with the molecular formula C24H23NO9 and a molecular weight of 469.4 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid. InChIKey: ZONKPOICDFFRNF-MJRVOHGCSA-N.
| Molecular formula | C24H23NO9 |
|---|---|
| Molecular weight | 469.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoyloxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | ZONKPOICDFFRNF-MJRVOHGCSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)