Products 90288-29-2
CAS 90288-29-2 is the registry number for [R-(Z)]-4-Amino-3-chloro-2-pen-tenedioicacid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z,4R)-4-amino-3-chloropent-2-enedioic acid (CAS 90288-29-2) is a chemical compound with the molecular formula C5H6ClNO4 and a molecular weight of 179.56 g/mol. IUPAC name: (Z,4R)-4-amino-3-chloropent-2-enedioic acid. InChIKey: OZYCMBRXDKOFGB-XDSMRRFISA-N.
| Molecular formula | C5H6ClNO4 |
|---|---|
| Molecular weight | 179.56 g/mol |
| IUPAC name | (Z,4R)-4-amino-3-chloropent-2-enedioic acid |
| InChIKey | OZYCMBRXDKOFGB-XDSMRRFISA-N |
| SMILES | C(=C(/[C@@H](C(=O)O)N)\Cl)\C(=O)O |
Computed by PubChem (NCBI)