CAS 90345-62-3 appears in our catalog under these names: 3-Methanesulfinylbenzoic acid, 3-Methanesulfinylbenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
3-methylsulfinylbenzoic acid (CAS 90345-62-3) is a chemical compound with the molecular formula C8H8O3S and a molecular weight of 184.21 g/mol. IUPAC name: 3-methylsulfinylbenzoic acid. InChIKey: VTXKMQSHSSNEJF-UHFFFAOYSA-N.
| Molecular formula | C8H8O3S |
|---|---|
| Molecular weight | 184.21 g/mol |
| IUPAC name | 3-methylsulfinylbenzoic acid |
| InChIKey | VTXKMQSHSSNEJF-UHFFFAOYSA-N |
| SMILES | CS(=O)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)