Products 903556-72-9
CAS 903556-72-9 is the registry number for 2,2-Dimethyl-2,3-dihydro-1-benzofuran-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-3H-1-benzofuran-5-carbonitrile (CAS 903556-72-9) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2,2-dimethyl-3H-1-benzofuran-5-carbonitrile. InChIKey: MTNQNFQWBVATMN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2,2-dimethyl-3H-1-benzofuran-5-carbonitrile |
| InChIKey | MTNQNFQWBVATMN-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C=CC(=C2)C#N)C |
Computed by PubChem (NCBI)