Products 903557-27-7
CAS 903557-27-7 is the registry number for 4-Bromo-2,3-dihydro-1H-inden-1-one oxime, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
(NE)-N-(4-bromo-2,3-dihydroinden-1-ylidene)hydroxylamine (CAS 903557-27-7) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: (NE)-N-(4-bromo-2,3-dihydroinden-1-ylidene)hydroxylamine. InChIKey: ZAANKHXRIRMKFF-PKNBQFBNSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | (NE)-N-(4-bromo-2,3-dihydroinden-1-ylidene)hydroxylamine |
| InChIKey | ZAANKHXRIRMKFF-PKNBQFBNSA-N |
| SMILES | C1C/C(=N\O)/C2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)