CAS 903591-53-7 appears in our catalog under these names: AMG1, 95%, CRAC channel inhibitor-1. Offered by: AmBeed, MedChemExpress. Available pack sizes: 1g, Get quote.
N-[5-[2-chloro-5-(trifluoromethyl)phenyl]pyrazin-2-yl]-2,6-difluorobenzamide (CAS 903591-53-7) is a chemical compound with the molecular formula C18H9ClF5N3O and a molecular weight of 413.7 g/mol. IUPAC name: N-[5-[2-chloro-5-(trifluoromethyl)phenyl]pyrazin-2-yl]-2,6-difluorobenzamide. InChIKey: LWJKSVUJZBEXCH-UHFFFAOYSA-N.
| Molecular formula | C18H9ClF5N3O |
|---|---|
| Molecular weight | 413.7 g/mol |
| IUPAC name | N-[5-[2-chloro-5-(trifluoromethyl)phenyl]pyrazin-2-yl]-2,6-difluorobenzamide |
| InChIKey | LWJKSVUJZBEXCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC2=NC=C(N=C2)C3=C(C=CC(=C3)C(F)(F)F)Cl)F |
Computed by PubChem (NCBI)