Products 90365-12-1

CAS 90365-12-1 is the registry number for Diethyl (2R,5R)-1-benzylpyrrolidine-2,5-dicarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Diethyl (2R,5R)-1-benzylpyrrolidine-2,5-dicarboxylate (CAS 90365-12-1) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: diethyl (2R,5R)-1-benzylpyrrolidine-2,5-dicarboxylate. InChIKey: LDUSEIANLSWKPY-HUUCEWRRSA-N.

Identity
Molecular formulaC17H23NO4
Molecular weight305.4 g/mol
IUPAC namediethyl (2R,5R)-1-benzylpyrrolidine-2,5-dicarboxylate
InChIKeyLDUSEIANLSWKPY-HUUCEWRRSA-N
SMILESCCOC(=O)[C@H]1CC[C@@H](N1CC2=CC=CC=C2)C(=O)OCC

Computed by PubChem (NCBI)